C19H25N5O2 — CID 134698678
N-(2-butyl-5-methylpyrazol-3-yl)-5-oxo-1-(pyridin-4-ylmethyl)pyrrolidine-3-carboxamide (PubChem CID 134698678) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-(2-butyl-5-methylpyrazol-3-yl)-5-oxo-1-(pyridin-4-ylmethyl)pyrrolidine-3-carboxamide.
| Compound Name | N-(2-butyl-5-methylpyrazol-3-yl)-5-oxo-1-(pyridin-4-ylmethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134698678 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | N-(2-butyl-5-methylpyrazol-3-yl)-5-oxo-1-(pyridin-4-ylmethyl)pyrrolidine-3-carboxamide |
| SMILES | CCCCn1nc(C)cc1NC(=O)C1CC(=O)N(Cc2ccncc2)C1 |
| InChI | InChI=1S/C19H25N5O2/c1-3-4-9-24-17(10-14(2)22-24)21-19(26)16-11-18(25)23(13-16)12-15-5-7-20-8-6-15/h5-8,10,16H,3-4,9,11-13H2,1-2H3,(H,21,26) |
| InChIKey | LVQXHWLYDGHWDO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |