C14H23N5 — CID 134698846
N,N-dimethyl-6-[4-(2-methylprop-2-enyl)piperazin-1-yl]pyrazin-2-amine (PubChem CID 134698846) has the molecular formula C14H23N5 and a molecular weight of 261.37 g/mol. Its IUPAC name is N,N-dimethyl-6-[4-(2-methylprop-2-enyl)piperazin-1-yl]pyrazin-2-amine.
| Compound Name | N,N-dimethyl-6-[4-(2-methylprop-2-enyl)piperazin-1-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 134698846 |
| Molecular Formula | C14H23N5 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | N,N-dimethyl-6-[4-(2-methylprop-2-enyl)piperazin-1-yl]pyrazin-2-amine |
| SMILES | C=C(C)CN1CCN(c2cncc(N(C)C)n2)CC1 |
| InChI | InChI=1S/C14H23N5/c1-12(2)11-18-5-7-19(8-6-18)14-10-15-9-13(16-14)17(3)4/h9-10H,1,5-8,11H2,2-4H3 |
| InChIKey | NGCPLUHQSVWUMO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|