C13H22FN3O2 — CID 134699996
2-ethyl-2-[[(5-fluoro-4-methoxypyrimidin-2-yl)-methylamino]methyl]butan-1-ol (PubChem CID 134699996) has the molecular formula C13H22FN3O2 and a molecular weight of 271.34 g/mol. Its IUPAC name is 2-ethyl-2-[[(5-fluoro-4-methoxypyrimidin-2-yl)-methylamino]methyl]butan-1-ol.
| Compound Name | 2-ethyl-2-[[(5-fluoro-4-methoxypyrimidin-2-yl)-methylamino]methyl]butan-1-ol |
|---|---|
| PubChem CID | 134699996 |
| Molecular Formula | C13H22FN3O2 |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 2-ethyl-2-[[(5-fluoro-4-methoxypyrimidin-2-yl)-methylamino]methyl]butan-1-ol |
| SMILES | CCC(CC)(CO)CN(C)c1ncc(F)c(OC)n1 |
| InChI | InChI=1S/C13H22FN3O2/c1-5-13(6-2,9-18)8-17(3)12-15-7-10(14)11(16-12)19-4/h7,18H,5-6,8-9H2,1-4H3 |
| InChIKey | YSZCXYOCHKNFSU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |