About 3-[(1,4-dithiepan-6-ylamino)methyl]pyrrolidin-3-ol
3-[(1,4-dithiepan-6-ylamino)methyl]pyrrolidin-3-ol (PubChem CID 134700128) has the molecular formula C10H20N2OS2
and a molecular weight of 248.42 g/mol. Its IUPAC name is 3-[(1,4-dithiepan-6-ylamino)methyl]pyrrolidin-3-ol.
Molecular Properties
| Compound Name | 3-[(1,4-dithiepan-6-ylamino)methyl]pyrrolidin-3-ol |
| PubChem CID | 134700128 |
| Molecular Formula | C10H20N2OS2 |
| Molecular Weight | 248.42 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 3-[(1,4-dithiepan-6-ylamino)methyl]pyrrolidin-3-ol |
| SMILES | OC1(CNC2CSCCSC2)CCNC1 |
| InChI | InChI=1S/C10H20N2OS2/c13-10(1-2-11-7-10)8-12-9-5-14-3-4-15-6-9/h9,11-13H,1-8H2 |
| InChIKey | CJQVKWWLUVZBHS-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.42 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(1,4-dithiepan-6-ylamino)methyl]pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1,4-dithiepan-6-ylamino)methyl]pyrrolidin-3-ol?
The IUPAC name of 3-[(1,4-dithiepan-6-ylamino)methyl]pyrrolidin-3-ol (CID 134700128) is 3-[(1,4-dithiepan-6-ylamino)methyl]pyrrolidin-3-ol.
What is the SMILES notation for 3-[(1,4-dithiepan-6-ylamino)methyl]pyrrolidin-3-ol?
The canonical SMILES for 3-[(1,4-dithiepan-6-ylamino)methyl]pyrrolidin-3-ol is OC1(CNC2CSCCSC2)CCNC1.
What is the InChIKey of 3-[(1,4-dithiepan-6-ylamino)methyl]pyrrolidin-3-ol?
The InChIKey is CJQVKWWLUVZBHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2OS2/c13-10(1-2-11-7-10)8-12-9-5-14-3-4-15-6-9/h9,11-13H,1-8H2.
What are the key properties of 3-[(1,4-dithiepan-6-ylamino)methyl]pyrrolidin-3-ol?
3-[(1,4-dithiepan-6-ylamino)methyl]pyrrolidin-3-ol has a molecular weight of 248.42 g/mol, XLogP of 0.15, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,4-dithiepan-6-ylamino)methyl]pyrrolidin-3-ol is sourced from PubChem (CID 134700128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).