C16H26FN5O — CID 134700480
1-[4-[[4-(dimethylamino)-5-fluoropyrimidin-2-yl]amino]piperidin-1-yl]-3-methylbutan-1-one (PubChem CID 134700480) has the molecular formula C16H26FN5O and a molecular weight of 323.42 g/mol. Its IUPAC name is 1-[4-[[4-(dimethylamino)-5-fluoropyrimidin-2-yl]amino]piperidin-1-yl]-3-methylbutan-1-one.
| Compound Name | 1-[4-[[4-(dimethylamino)-5-fluoropyrimidin-2-yl]amino]piperidin-1-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 134700480 |
| Molecular Formula | C16H26FN5O |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 1-[4-[[4-(dimethylamino)-5-fluoropyrimidin-2-yl]amino]piperidin-1-yl]-3-methylbutan-1-one |
| SMILES | CC(C)CC(=O)N1CCC(Nc2ncc(F)c(N(C)C)n2)CC1 |
| InChI | InChI=1S/C16H26FN5O/c1-11(2)9-14(23)22-7-5-12(6-8-22)19-16-18-10-13(17)15(20-16)21(3)4/h10-12H,5-9H2,1-4H3,(H,18,19,20) |
| InChIKey | IENDGCXURCCVHF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |