C21H26FN3O2 — CID 134701040
N-[(4aR,6R,7aR)-2-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-6-yl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-methylacetamide (PubChem CID 134701040) has the molecular formula C21H26FN3O2 and a molecular weight of 371.46 g/mol. Its IUPAC name is N-[(4aR,6R,7aR)-2-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-6-yl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-methylacetamide.
| Compound Name | N-[(4aR,6R,7aR)-2-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-6-yl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 134701040 |
| Molecular Formula | C21H26FN3O2 |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | N-[(4aR,6R,7aR)-2-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-6-yl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-methylacetamide |
| SMILES | Cc1[nH]c2ccc(F)cc2c1CC(=O)N(C)[C@@H]1C[C@@H]2CC(=O)N(C)C[C@@H]2C1 |
| InChI | InChI=1S/C21H26FN3O2/c1-12-17(18-9-15(22)4-5-19(18)23-12)10-21(27)25(3)16-6-13-8-20(26)24(2)11-14(13)7-16/h4-5,9,13-14,16,23H,6-8,10-11H2,1-3H3/t13-,14+,16-/m1/s1 |
| InChIKey | PVJACLJFTZWKSC-IJEWVQPXSA-N |
| XLogP | 2.87 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|