About N-(4-ethyl-1,3-dimethylpyrazol-5-yl)-4-(4-methylpiperazin-1-yl)pentanamide
N-(4-ethyl-1,3-dimethylpyrazol-5-yl)-4-(4-methylpiperazin-1-yl)pentanamide (PubChem CID 134701340) has the molecular formula C17H31N5O
and a molecular weight of 321.47 g/mol. Its IUPAC name is N-(4-ethyl-1,3-dimethylpyrazol-5-yl)-4-(4-methylpiperazin-1-yl)pentanamide.
Molecular Properties
| Compound Name | N-(4-ethyl-1,3-dimethylpyrazol-5-yl)-4-(4-methylpiperazin-1-yl)pentanamide |
| PubChem CID | 134701340 |
| Molecular Formula | C17H31N5O |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.25 |
| IUPAC Name | N-(4-ethyl-1,3-dimethylpyrazol-5-yl)-4-(4-methylpiperazin-1-yl)pentanamide |
| SMILES | CCc1c(C)nn(C)c1NC(=O)CCC(C)N1CCN(C)CC1 |
| InChI | InChI=1S/C17H31N5O/c1-6-15-14(3)19-21(5)17(15)18-16(23)8-7-13(2)22-11-9-20(4)10-12-22/h13H,6-12H2,1-5H3,(H,18,23) |
| InChIKey | RVDPSMRPTYZECQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4-ethyl-1,3-dimethylpyrazol-5-yl)-4-(4-methylpiperazin-1-yl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-ethyl-1,3-dimethylpyrazol-5-yl)-4-(4-methylpiperazin-1-yl)pentanamide?
The IUPAC name of N-(4-ethyl-1,3-dimethylpyrazol-5-yl)-4-(4-methylpiperazin-1-yl)pentanamide (CID 134701340) is N-(4-ethyl-1,3-dimethylpyrazol-5-yl)-4-(4-methylpiperazin-1-yl)pentanamide.
What is the SMILES notation for N-(4-ethyl-1,3-dimethylpyrazol-5-yl)-4-(4-methylpiperazin-1-yl)pentanamide?
The canonical SMILES for N-(4-ethyl-1,3-dimethylpyrazol-5-yl)-4-(4-methylpiperazin-1-yl)pentanamide is CCc1c(C)nn(C)c1NC(=O)CCC(C)N1CCN(C)CC1.
What is the InChIKey of N-(4-ethyl-1,3-dimethylpyrazol-5-yl)-4-(4-methylpiperazin-1-yl)pentanamide?
The InChIKey is RVDPSMRPTYZECQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31N5O/c1-6-15-14(3)19-21(5)17(15)18-16(23)8-7-13(2)22-11-9-20(4)10-12-22/h13H,6-12H2,1-5H3,(H,18,23).
What are the key properties of N-(4-ethyl-1,3-dimethylpyrazol-5-yl)-4-(4-methylpiperazin-1-yl)pentanamide?
N-(4-ethyl-1,3-dimethylpyrazol-5-yl)-4-(4-methylpiperazin-1-yl)pentanamide has a molecular weight of 321.47 g/mol, XLogP of 1.65, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-ethyl-1,3-dimethylpyrazol-5-yl)-4-(4-methylpiperazin-1-yl)pentanamide is sourced from PubChem (CID 134701340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).