C19H28N2O3 — CID 134702400
1-[(4S,9aR)-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-3-phenoxypropan-1-one (PubChem CID 134702400) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is 1-[(4S,9aR)-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-3-phenoxypropan-1-one.
| Compound Name | 1-[(4S,9aR)-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-3-phenoxypropan-1-one |
|---|---|
| PubChem CID | 134702400 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 1-[(4S,9aR)-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-3-phenoxypropan-1-one |
| SMILES | CCC[C@H]1COC[C@H]2CN(C(=O)CCOc3ccccc3)CCN12 |
| InChI | InChI=1S/C19H28N2O3/c1-2-6-16-14-23-15-17-13-20(10-11-21(16)17)19(22)9-12-24-18-7-4-3-5-8-18/h3-5,7-8,16-17H,2,6,9-15H2,1H3/t16-,17+/m0/s1 |
| InChIKey | JJCBMGQAPPRVBY-DLBZAZTESA-N |
| XLogP | 2.17 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |