C16H25N3O — CID 134703983
(3S,4R)-1-(cyclohexylmethyl)-4-(pyrazin-2-ylmethyl)pyrrolidin-3-ol (PubChem CID 134703983) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is (3S,4R)-1-(cyclohexylmethyl)-4-(pyrazin-2-ylmethyl)pyrrolidin-3-ol.
| Compound Name | (3S,4R)-1-(cyclohexylmethyl)-4-(pyrazin-2-ylmethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 134703983 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | (3S,4R)-1-(cyclohexylmethyl)-4-(pyrazin-2-ylmethyl)pyrrolidin-3-ol |
| SMILES | O[C@@H]1CN(CC2CCCCC2)C[C@H]1Cc1cnccn1 |
| InChI | InChI=1S/C16H25N3O/c20-16-12-19(10-13-4-2-1-3-5-13)11-14(16)8-15-9-17-6-7-18-15/h6-7,9,13-14,16,20H,1-5,8,10-12H2/t14-,16-/m1/s1 |
| InChIKey | GWYQYCBFVUFNER-GDBMZVCRSA-N |
| XLogP | 1.89 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |