C19H25FN2O3 — CID 134704994
N-[3-[[(3aR,6aS)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-methylamino]-3-oxopropyl]-4-fluorobenzamide (PubChem CID 134704994) has the molecular formula C19H25FN2O3 and a molecular weight of 348.42 g/mol. Its IUPAC name is N-[3-[[(3aR,6aS)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-methylamino]-3-oxopropyl]-4-fluorobenzamide.
| Compound Name | N-[3-[[(3aR,6aS)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-methylamino]-3-oxopropyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 134704994 |
| Molecular Formula | C19H25FN2O3 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | N-[3-[[(3aR,6aS)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-methylamino]-3-oxopropyl]-4-fluorobenzamide |
| SMILES | CN(C(=O)CCNC(=O)c1ccc(F)cc1)C1C[C@H]2CC(O)C[C@H]2C1 |
| InChI | InChI=1S/C19H25FN2O3/c1-22(16-8-13-10-17(23)11-14(13)9-16)18(24)6-7-21-19(25)12-2-4-15(20)5-3-12/h2-5,13-14,16-17,23H,6-11H2,1H3,(H,21,25)/t13-,14+,16?,17? |
| InChIKey | GPPMOBQTACQRTA-CBHXASLJSA-N |
| XLogP | 1.95 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |