C18H25FN4O — CID 134705374
N-(2-butan-2-yl-5-methylpyrazol-3-yl)-2-[(4-fluorophenyl)methyl-methylamino]acetamide (PubChem CID 134705374) has the molecular formula C18H25FN4O and a molecular weight of 332.42 g/mol. Its IUPAC name is N-(2-butan-2-yl-5-methylpyrazol-3-yl)-2-[(4-fluorophenyl)methyl-methylamino]acetamide.
| Compound Name | N-(2-butan-2-yl-5-methylpyrazol-3-yl)-2-[(4-fluorophenyl)methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 134705374 |
| Molecular Formula | C18H25FN4O |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | N-(2-butan-2-yl-5-methylpyrazol-3-yl)-2-[(4-fluorophenyl)methyl-methylamino]acetamide |
| SMILES | CCC(C)n1nc(C)cc1NC(=O)CN(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C18H25FN4O/c1-5-14(3)23-17(10-13(2)21-23)20-18(24)12-22(4)11-15-6-8-16(19)9-7-15/h6-10,14H,5,11-12H2,1-4H3,(H,20,24) |
| InChIKey | VSXGJJUYBOBPBU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |