C20H24N2O2 — CID 134706148
[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]-pyridin-2-ylmethanone (PubChem CID 134706148) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is [(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]-pyridin-2-ylmethanone.
| Compound Name | [(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 134706148 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | [(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]-pyridin-2-ylmethanone |
| SMILES | CC(C)(C)[C@H]1CN(C(=O)c2ccccn2)C[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C20H24N2O2/c1-20(2,3)18-14-22(19(23)16-11-7-8-12-21-16)13-17(24-18)15-9-5-4-6-10-15/h4-12,17-18H,13-14H2,1-3H3/t17-,18+/m0/s1 |
| InChIKey | VLESZTYMCUHDBR-ZWKOTPCHSA-N |
| XLogP | 3.71 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |