C16H25N3O5 — CID 134706242
5-[[[2-[methyl(2-morpholin-4-ylpropyl)amino]acetyl]amino]methyl]furan-2-carboxylic acid (PubChem CID 134706242) has the molecular formula C16H25N3O5 and a molecular weight of 339.39 g/mol. Its IUPAC name is 5-[[[2-[methyl(2-morpholin-4-ylpropyl)amino]acetyl]amino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[[2-[methyl(2-morpholin-4-ylpropyl)amino]acetyl]amino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 134706242 |
| Molecular Formula | C16H25N3O5 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 5-[[[2-[methyl(2-morpholin-4-ylpropyl)amino]acetyl]amino]methyl]furan-2-carboxylic acid |
| SMILES | CC(CN(C)CC(=O)NCc1ccc(C(=O)O)o1)N1CCOCC1 |
| InChI | InChI=1S/C16H25N3O5/c1-12(19-5-7-23-8-6-19)10-18(2)11-15(20)17-9-13-3-4-14(24-13)16(21)22/h3-4,12H,5-11H2,1-2H3,(H,17,20)(H,21,22) |
| InChIKey | SBFOPFFVUKFLGZ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 95.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |