C20H25NO2 — CID 134706362
(3aR,6aS)-5-[[2-(furan-2-yl)phenyl]methyl-methylamino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol (PubChem CID 134706362) has the molecular formula C20H25NO2 and a molecular weight of 311.42 g/mol. Its IUPAC name is (3aR,6aS)-5-[[2-(furan-2-yl)phenyl]methyl-methylamino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol.
| Compound Name | (3aR,6aS)-5-[[2-(furan-2-yl)phenyl]methyl-methylamino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol |
|---|---|
| PubChem CID | 134706362 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | (3aR,6aS)-5-[[2-(furan-2-yl)phenyl]methyl-methylamino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol |
| SMILES | CN(Cc1ccccc1-c1ccco1)C1C[C@H]2CC(O)C[C@H]2C1 |
| InChI | InChI=1S/C20H25NO2/c1-21(17-9-15-11-18(22)12-16(15)10-17)13-14-5-2-3-6-19(14)20-7-4-8-23-20/h2-8,15-18,22H,9-13H2,1H3/t15-,16+,17?,18? |
| InChIKey | WCNIZMPIMPVHHN-OQSMONGASA-N |
| XLogP | 3.93 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |