C14H17F3N2O4S — CID 134706591
1-[(3R,4S)-4-hydroxy-1-(2,4,5-trifluorobenzoyl)pyrrolidin-3-yl]-N,N-dimethylmethanesulfonamide (PubChem CID 134706591) has the molecular formula C14H17F3N2O4S and a molecular weight of 366.36 g/mol. Its IUPAC name is 1-[(3R,4S)-4-hydroxy-1-(2,4,5-trifluorobenzoyl)pyrrolidin-3-yl]-N,N-dimethylmethanesulfonamide.
| Compound Name | 1-[(3R,4S)-4-hydroxy-1-(2,4,5-trifluorobenzoyl)pyrrolidin-3-yl]-N,N-dimethylmethanesulfonamide |
|---|---|
| PubChem CID | 134706591 |
| Molecular Formula | C14H17F3N2O4S |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 1-[(3R,4S)-4-hydroxy-1-(2,4,5-trifluorobenzoyl)pyrrolidin-3-yl]-N,N-dimethylmethanesulfonamide |
| SMILES | CN(C)S(=O)(=O)C[C@@H]1CN(C(=O)c2cc(F)c(F)cc2F)C[C@H]1O |
| InChI | InChI=1S/C14H17F3N2O4S/c1-18(2)24(22,23)7-8-5-19(6-13(8)20)14(21)9-3-11(16)12(17)4-10(9)15/h3-4,8,13,20H,5-7H2,1-2H3/t8-,13+/m0/s1 |
| InChIKey | ULWBEPZQOYTKOU-ISVAXAHUSA-N |
| XLogP | 0.43 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|