C18H26N6 — CID 134706682
2-N,2-N-dimethyl-4-N-[3-(pyridin-3-ylamino)propyl]-5,6,7,8-tetrahydroquinazoline-2,4-diamine (PubChem CID 134706682) has the molecular formula C18H26N6 and a molecular weight of 326.45 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-4-N-[3-(pyridin-3-ylamino)propyl]-5,6,7,8-tetrahydroquinazoline-2,4-diamine.
| Compound Name | 2-N,2-N-dimethyl-4-N-[3-(pyridin-3-ylamino)propyl]-5,6,7,8-tetrahydroquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 134706682 |
| Molecular Formula | C18H26N6 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 2-N,2-N-dimethyl-4-N-[3-(pyridin-3-ylamino)propyl]-5,6,7,8-tetrahydroquinazoline-2,4-diamine |
| SMILES | CN(C)c1nc2c(c(NCCCNc3cccnc3)n1)CCCC2 |
| InChI | InChI=1S/C18H26N6/c1-24(2)18-22-16-9-4-3-8-15(16)17(23-18)21-12-6-11-20-14-7-5-10-19-13-14/h5,7,10,13,20H,3-4,6,8-9,11-12H2,1-2H3,(H,21,22,23) |
| InChIKey | LAQQPYNZEDRWPF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|