C15H23N3O2 — CID 134707087
(3aR,6aS)-5-[(2-methoxypyrimidin-5-yl)methyl-methylamino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol (PubChem CID 134707087) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is (3aR,6aS)-5-[(2-methoxypyrimidin-5-yl)methyl-methylamino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol.
| Compound Name | (3aR,6aS)-5-[(2-methoxypyrimidin-5-yl)methyl-methylamino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol |
|---|---|
| PubChem CID | 134707087 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | (3aR,6aS)-5-[(2-methoxypyrimidin-5-yl)methyl-methylamino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol |
| SMILES | COc1ncc(CN(C)C2C[C@H]3CC(O)C[C@H]3C2)cn1 |
| InChI | InChI=1S/C15H23N3O2/c1-18(9-10-7-16-15(20-2)17-8-10)13-3-11-5-14(19)6-12(11)4-13/h7-8,11-14,19H,3-6,9H2,1-2H3/t11-,12+,13?,14? |
| InChIKey | TZVMRFUJVMINFL-VTXSZYRJSA-N |
| XLogP | 1.47 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |