About 5-fluoro-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-4-pyrrolidin-1-ylpyrimidin-2-amine
5-fluoro-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-4-pyrrolidin-1-ylpyrimidin-2-amine (PubChem CID 134707806) has the molecular formula C15H17FN6S
and a molecular weight of 332.41 g/mol. Its IUPAC name is 5-fluoro-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-4-pyrrolidin-1-ylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-fluoro-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-4-pyrrolidin-1-ylpyrimidin-2-amine |
| PubChem CID | 134707806 |
| Molecular Formula | C15H17FN6S |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 5-fluoro-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-4-pyrrolidin-1-ylpyrimidin-2-amine |
| SMILES | Fc1cnc(NCCc2cn3ccsc3n2)nc1N1CCCC1 |
| InChI | InChI=1S/C15H17FN6S/c16-12-9-18-14(20-13(12)21-5-1-2-6-21)17-4-3-11-10-22-7-8-23-15(22)19-11/h7-10H,1-6H2,(H,17,18,20) |
| InChIKey | PYYXDDHVVTVTGP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-fluoro-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-4-pyrrolidin-1-ylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-4-pyrrolidin-1-ylpyrimidin-2-amine?
The IUPAC name of 5-fluoro-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-4-pyrrolidin-1-ylpyrimidin-2-amine (CID 134707806) is 5-fluoro-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-4-pyrrolidin-1-ylpyrimidin-2-amine.
What is the SMILES notation for 5-fluoro-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-4-pyrrolidin-1-ylpyrimidin-2-amine?
The canonical SMILES for 5-fluoro-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-4-pyrrolidin-1-ylpyrimidin-2-amine is Fc1cnc(NCCc2cn3ccsc3n2)nc1N1CCCC1.
What is the InChIKey of 5-fluoro-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-4-pyrrolidin-1-ylpyrimidin-2-amine?
The InChIKey is PYYXDDHVVTVTGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17FN6S/c16-12-9-18-14(20-13(12)21-5-1-2-6-21)17-4-3-11-10-22-7-8-23-15(22)19-11/h7-10H,1-6H2,(H,17,18,20).
What are the key properties of 5-fluoro-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-4-pyrrolidin-1-ylpyrimidin-2-amine?
5-fluoro-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-4-pyrrolidin-1-ylpyrimidin-2-amine has a molecular weight of 332.41 g/mol, XLogP of 2.58, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-4-pyrrolidin-1-ylpyrimidin-2-amine is sourced from PubChem (CID 134707806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).