C14H22N4O — CID 134709771
(3aS,6aR)-5-[(2-aminopyrimidin-5-yl)methyl-methylamino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol (PubChem CID 134709771) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is (3aS,6aR)-5-[(2-aminopyrimidin-5-yl)methyl-methylamino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol.
| Compound Name | (3aS,6aR)-5-[(2-aminopyrimidin-5-yl)methyl-methylamino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol |
|---|---|
| PubChem CID | 134709771 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | (3aS,6aR)-5-[(2-aminopyrimidin-5-yl)methyl-methylamino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol |
| SMILES | CN(Cc1cnc(N)nc1)C1C[C@H]2CC(O)C[C@H]2C1 |
| InChI | InChI=1S/C14H22N4O/c1-18(8-9-6-16-14(15)17-7-9)12-2-10-4-13(19)5-11(10)3-12/h6-7,10-13,19H,2-5,8H2,1H3,(H2,15,16,17)/t10-,11+,12?,13? |
| InChIKey | UXCNWXSRLUORJI-MPEURRAXSA-N |
| XLogP | 1.04 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |