C19H26N2O3 — CID 134710331
(5R,6S)-6-(azepane-1-carbonyl)-4-methyl-5-(2-methylphenyl)morpholin-3-one (PubChem CID 134710331) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is (5R,6S)-6-(azepane-1-carbonyl)-4-methyl-5-(2-methylphenyl)morpholin-3-one.
| Compound Name | (5R,6S)-6-(azepane-1-carbonyl)-4-methyl-5-(2-methylphenyl)morpholin-3-one |
|---|---|
| PubChem CID | 134710331 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (5R,6S)-6-(azepane-1-carbonyl)-4-methyl-5-(2-methylphenyl)morpholin-3-one |
| SMILES | Cc1ccccc1[C@@H]1[C@@H](C(=O)N2CCCCCC2)OCC(=O)N1C |
| InChI | InChI=1S/C19H26N2O3/c1-14-9-5-6-10-15(14)17-18(24-13-16(22)20(17)2)19(23)21-11-7-3-4-8-12-21/h5-6,9-10,17-18H,3-4,7-8,11-13H2,1-2H3/t17-,18+/m1/s1 |
| InChIKey | RJXDHNXGYHOIPB-MSOLQXFVSA-N |
| XLogP | 2.30 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |