C13H26N2O2 — CID 134711652
2-[2-(3-methoxypropyl)piperidin-1-yl]-N,N-dimethylacetamide (PubChem CID 134711652) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 2-[2-(3-methoxypropyl)piperidin-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[2-(3-methoxypropyl)piperidin-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 134711652 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 2-[2-(3-methoxypropyl)piperidin-1-yl]-N,N-dimethylacetamide |
| SMILES | COCCCC1CCCCN1CC(=O)N(C)C |
| InChI | InChI=1S/C13H26N2O2/c1-14(2)13(16)11-15-9-5-4-7-12(15)8-6-10-17-3/h12H,4-11H2,1-3H3 |
| InChIKey | GVENQNCLMFSZQT-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|