C22H27N3O4 — CID 134711808
1-[4-[3-(3-methoxyphenyl)propanoyl]-1,4-diazepan-1-yl]-2-(1-methylpyrrol-2-yl)ethane-1,2-dione (PubChem CID 134711808) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is 1-[4-[3-(3-methoxyphenyl)propanoyl]-1,4-diazepan-1-yl]-2-(1-methylpyrrol-2-yl)ethane-1,2-dione.
| Compound Name | 1-[4-[3-(3-methoxyphenyl)propanoyl]-1,4-diazepan-1-yl]-2-(1-methylpyrrol-2-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 134711808 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 1-[4-[3-(3-methoxyphenyl)propanoyl]-1,4-diazepan-1-yl]-2-(1-methylpyrrol-2-yl)ethane-1,2-dione |
| SMILES | COc1cccc(CCC(=O)N2CCCN(C(=O)C(=O)c3cccn3C)CC2)c1 |
| InChI | InChI=1S/C22H27N3O4/c1-23-11-4-8-19(23)21(27)22(28)25-13-5-12-24(14-15-25)20(26)10-9-17-6-3-7-18(16-17)29-2/h3-4,6-8,11,16H,5,9-10,12-15H2,1-2H3 |
| InChIKey | MPWMUMIJOYUXOR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|