C17H21F4NO — CID 134712560
(3aR,6aS)-5-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl-methylamino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol (PubChem CID 134712560) has the molecular formula C17H21F4NO and a molecular weight of 331.35 g/mol. Its IUPAC name is (3aR,6aS)-5-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl-methylamino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol.
| Compound Name | (3aR,6aS)-5-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl-methylamino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol |
|---|---|
| PubChem CID | 134712560 |
| Molecular Formula | C17H21F4NO |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | (3aR,6aS)-5-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl-methylamino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol |
| SMILES | CN(Cc1cc(C(F)(F)F)ccc1F)C1C[C@H]2CC(O)C[C@H]2C1 |
| InChI | InChI=1S/C17H21F4NO/c1-22(14-5-10-7-15(23)8-11(10)6-14)9-12-4-13(17(19,20)21)2-3-16(12)18/h2-4,10-11,14-15,23H,5-9H2,1H3/t10-,11+,14?,15? |
| InChIKey | NEDFJWFIKJBMDE-MPLXBHQASA-N |
| XLogP | 3.83 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |