C20H31NO — CID 134712968
(3aR,6aS)-5-[(4-tert-butylphenyl)methyl-methylamino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol (PubChem CID 134712968) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is (3aR,6aS)-5-[(4-tert-butylphenyl)methyl-methylamino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol.
| Compound Name | (3aR,6aS)-5-[(4-tert-butylphenyl)methyl-methylamino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol |
|---|---|
| PubChem CID | 134712968 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | (3aR,6aS)-5-[(4-tert-butylphenyl)methyl-methylamino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol |
| SMILES | CN(Cc1ccc(C(C)(C)C)cc1)C1C[C@H]2CC(O)C[C@H]2C1 |
| InChI | InChI=1S/C20H31NO/c1-20(2,3)17-7-5-14(6-8-17)13-21(4)18-9-15-11-19(22)12-16(15)10-18/h5-8,15-16,18-19,22H,9-13H2,1-4H3/t15-,16+,18?,19? |
| InChIKey | XYTCXZJWBAVWPI-CCZBSFLLSA-N |
| XLogP | 3.97 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |