C18H24F2N2O2 — CID 134713826
(4aS,8aS)-7-[(2,6-difluoro-3-methylphenyl)methyl]-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-4a-carboxylic acid (PubChem CID 134713826) has the molecular formula C18H24F2N2O2 and a molecular weight of 338.40 g/mol. Its IUPAC name is (4aS,8aS)-7-[(2,6-difluoro-3-methylphenyl)methyl]-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-4a-carboxylic acid.
| Compound Name | (4aS,8aS)-7-[(2,6-difluoro-3-methylphenyl)methyl]-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-4a-carboxylic acid |
|---|---|
| PubChem CID | 134713826 |
| Molecular Formula | C18H24F2N2O2 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | (4aS,8aS)-7-[(2,6-difluoro-3-methylphenyl)methyl]-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-4a-carboxylic acid |
| SMILES | Cc1ccc(F)c(CN2CC[C@@]3(C(=O)O)CCCN(C)[C@@H]3C2)c1F |
| InChI | InChI=1S/C18H24F2N2O2/c1-12-4-5-14(19)13(16(12)20)10-22-9-7-18(17(23)24)6-3-8-21(2)15(18)11-22/h4-5,15H,3,6-11H2,1-2H3,(H,23,24)/t15-,18+/m1/s1 |
| InChIKey | LKPKCBKTJJCGSQ-QAPCUYQASA-N |
| XLogP | 2.64 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |