C22H31N3O — CID 134713948
1-propyl-N-[(3R,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]piperidin-4-amine (PubChem CID 134713948) has the molecular formula C22H31N3O and a molecular weight of 353.51 g/mol. Its IUPAC name is 1-propyl-N-[(3R,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]piperidin-4-amine.
| Compound Name | 1-propyl-N-[(3R,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 134713948 |
| Molecular Formula | C22H31N3O |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | 1-propyl-N-[(3R,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]piperidin-4-amine |
| SMILES | CCCN1CCC(N[C@H]2COC[C@H]2Cc2ccnc3ccccc23)CC1 |
| InChI | InChI=1S/C22H31N3O/c1-2-11-25-12-8-19(9-13-25)24-22-16-26-15-18(22)14-17-7-10-23-21-6-4-3-5-20(17)21/h3-7,10,18-19,22,24H,2,8-9,11-16H2,1H3/t18-,22+/m1/s1 |
| InChIKey | XBAZSSHSXYMALJ-GCJKJVERSA-N |
| XLogP | 3.26 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |