C17H27N3O — CID 134714267
(3aR,6aS)-5-[methyl-[(2-propan-2-ylpyrimidin-5-yl)methyl]amino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol (PubChem CID 134714267) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is (3aR,6aS)-5-[methyl-[(2-propan-2-ylpyrimidin-5-yl)methyl]amino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol.
| Compound Name | (3aR,6aS)-5-[methyl-[(2-propan-2-ylpyrimidin-5-yl)methyl]amino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol |
|---|---|
| PubChem CID | 134714267 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | (3aR,6aS)-5-[methyl-[(2-propan-2-ylpyrimidin-5-yl)methyl]amino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol |
| SMILES | CC(C)c1ncc(CN(C)C2C[C@H]3CC(O)C[C@H]3C2)cn1 |
| InChI | InChI=1S/C17H27N3O/c1-11(2)17-18-8-12(9-19-17)10-20(3)15-4-13-6-16(21)7-14(13)5-15/h8-9,11,13-16,21H,4-7,10H2,1-3H3/t13-,14+,15?,16? |
| InChIKey | KZAWWYGGGMABOA-PJPHBNEVSA-N |
| XLogP | 2.58 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |