C20H33N7O2 — CID 134714431
N-tert-butyl-2-[4-[6-(4-methylpiperazine-1-carbonyl)pyrazin-2-yl]piperazin-1-yl]acetamide (PubChem CID 134714431) has the molecular formula C20H33N7O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is N-tert-butyl-2-[4-[6-(4-methylpiperazine-1-carbonyl)pyrazin-2-yl]piperazin-1-yl]acetamide.
| Compound Name | N-tert-butyl-2-[4-[6-(4-methylpiperazine-1-carbonyl)pyrazin-2-yl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 134714431 |
| Molecular Formula | C20H33N7O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | N-tert-butyl-2-[4-[6-(4-methylpiperazine-1-carbonyl)pyrazin-2-yl]piperazin-1-yl]acetamide |
| SMILES | CN1CCN(C(=O)c2cncc(N3CCN(CC(=O)NC(C)(C)C)CC3)n2)CC1 |
| InChI | InChI=1S/C20H33N7O2/c1-20(2,3)23-18(28)15-25-7-11-26(12-8-25)17-14-21-13-16(22-17)19(29)27-9-5-24(4)6-10-27/h13-14H,5-12,15H2,1-4H3,(H,23,28) |
| InChIKey | HAZBQQNQYJMMLL-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |