C14H23BN2O3 — CID 134714886
4-methyl-2-propan-2-yloxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine (PubChem CID 134714886) has the molecular formula C14H23BN2O3 and a molecular weight of 278.16 g/mol. Its IUPAC name is 4-methyl-2-propan-2-yloxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine.
| Compound Name | 4-methyl-2-propan-2-yloxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
|---|---|
| PubChem CID | 134714886 |
| Molecular Formula | C14H23BN2O3 |
| Molecular Weight | 278.16 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 4-methyl-2-propan-2-yloxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
| SMILES | Cc1nc(OC(C)C)ncc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H23BN2O3/c1-9(2)18-12-16-8-11(10(3)17-12)15-19-13(4,5)14(6,7)20-15/h8-9H,1-7H3 |
| InChIKey | LQRYNSXUJNYQBP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.16 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|