C22H33NO9 — CID 134714988
(1R,4R,5S,8R,9R,19R)-4,5,9-trihydroxy-8-methyl-4,9-di(propan-2-yl)-2,7,11-trioxa-16-azatricyclo[11.5.1.016,19]nonadec-13-ene-3,6,10-trione (PubChem CID 134714988) has the molecular formula C22H33NO9 and a molecular weight of 455.50 g/mol. Its IUPAC name is (1R,4R,5S,8R,9R,19R)-4,5,9-trihydroxy-8-methyl-4,9-di(propan-2-yl)-2,7,11-trioxa-16-azatricyclo[11.5.1.016,19]nonadec-13-ene-3,6,10-trione.
| Compound Name | (1R,4R,5S,8R,9R,19R)-4,5,9-trihydroxy-8-methyl-4,9-di(propan-2-yl)-2,7,11-trioxa-16-azatricyclo[11.5.1.016,19]nonadec-13-ene-3,6,10-trione |
|---|---|
| PubChem CID | 134714988 |
| Molecular Formula | C22H33NO9 |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | (1R,4R,5S,8R,9R,19R)-4,5,9-trihydroxy-8-methyl-4,9-di(propan-2-yl)-2,7,11-trioxa-16-azatricyclo[11.5.1.016,19]nonadec-13-ene-3,6,10-trione |
| SMILES | CC(C)[C@]1(O)C(=O)O[C@@H]2CCN3CC=C(COC(=O)[C@@](O)(C(C)C)[C@@H](C)OC(=O)[C@H]1O)[C@H]23 |
| InChI | InChI=1S/C22H33NO9/c1-11(2)21(28)13(5)31-18(25)17(24)22(29,12(3)4)20(27)32-15-7-9-23-8-6-14(16(15)23)10-30-19(21)26/h6,11-13,15-17,24,28-29H,7-10H2,1-5H3/t13-,15-,16-,17-,21-,22-/m1/s1 |
| InChIKey | SHUMEODPCRJUBC-PFZVPNPESA-N |
| XLogP | -0.46 |
| TPSA | 142.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|