C16H25NO6 — CID 134714998
(1R,4R,5R,6R,10R,16R)-5,6-dihydroxy-4,5,6-trimethyl-2,8-dioxa-13-azatricyclo[8.5.1.013,16]hexadecane-3,7-dione (PubChem CID 134714998) has the molecular formula C16H25NO6 and a molecular weight of 327.38 g/mol. Its IUPAC name is (1R,4R,5R,6R,10R,16R)-5,6-dihydroxy-4,5,6-trimethyl-2,8-dioxa-13-azatricyclo[8.5.1.013,16]hexadecane-3,7-dione.
| Compound Name | (1R,4R,5R,6R,10R,16R)-5,6-dihydroxy-4,5,6-trimethyl-2,8-dioxa-13-azatricyclo[8.5.1.013,16]hexadecane-3,7-dione |
|---|---|
| PubChem CID | 134714998 |
| Molecular Formula | C16H25NO6 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | (1R,4R,5R,6R,10R,16R)-5,6-dihydroxy-4,5,6-trimethyl-2,8-dioxa-13-azatricyclo[8.5.1.013,16]hexadecane-3,7-dione |
| SMILES | C[C@H]1C(=O)O[C@@H]2CCN3CC[C@@H](COC(=O)[C@](C)(O)[C@]1(C)O)[C@H]23 |
| InChI | InChI=1S/C16H25NO6/c1-9-13(18)23-11-5-7-17-6-4-10(12(11)17)8-22-14(19)16(3,21)15(9,2)20/h9-12,20-21H,4-8H2,1-3H3/t9-,10-,11+,12+,15+,16-/m0/s1 |
| InChIKey | IDBGJRAMJYRSKU-SRRKXDBNSA-N |
| XLogP | -0.31 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |