C22H22N2O6 — CID 134715333
N-(2-pyrrolidin-1-ylethyl)-2-(3,4,5-trihydroxybenzoyl)-1-benzofuran-5-carboxamide (PubChem CID 134715333) has the molecular formula C22H22N2O6 and a molecular weight of 410.43 g/mol. Its IUPAC name is N-(2-pyrrolidin-1-ylethyl)-2-(3,4,5-trihydroxybenzoyl)-1-benzofuran-5-carboxamide.
| Compound Name | N-(2-pyrrolidin-1-ylethyl)-2-(3,4,5-trihydroxybenzoyl)-1-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 134715333 |
| Molecular Formula | C22H22N2O6 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | N-(2-pyrrolidin-1-ylethyl)-2-(3,4,5-trihydroxybenzoyl)-1-benzofuran-5-carboxamide |
| SMILES | O=C(NCCN1CCCC1)c1ccc2oc(C(=O)c3cc(O)c(O)c(O)c3)cc2c1 |
| InChI | InChI=1S/C22H22N2O6/c25-16-10-15(11-17(26)21(16)28)20(27)19-12-14-9-13(3-4-18(14)30-19)22(29)23-5-8-24-6-1-2-7-24/h3-4,9-12,25-26,28H,1-2,5-8H2,(H,23,29) |
| InChIKey | FQUBMOYVKLVEKR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|