About azane;3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfanylpyrazolo[1,5-a]pyridine
azane;3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfanylpyrazolo[1,5-a]pyridine (PubChem CID 134715341) has the molecular formula C16H19N3O2S2
and a molecular weight of 349.48 g/mol. Its IUPAC name is azane;3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfanylpyrazolo[1,5-a]pyridine.
Molecular Properties
| Compound Name | azane;3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfanylpyrazolo[1,5-a]pyridine |
| PubChem CID | 134715341 |
| Molecular Formula | C16H19N3O2S2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | azane;3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfanylpyrazolo[1,5-a]pyridine |
| SMILES | CSc1nn2c(C)cc(C)cc2c1S(=O)(=O)c1ccccc1.N |
| InChI | InChI=1S/C16H16N2O2S2.H3N/c1-11-9-12(2)18-14(10-11)15(16(17-18)21-3)22(19,20)13-7-5-4-6-8-13;/h4-10H,1-3H3;1H3 |
| InChIKey | OCNFRNNUQABYAD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 86.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze azane;3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfanylpyrazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfanylpyrazolo[1,5-a]pyridine?
The IUPAC name of azane;3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfanylpyrazolo[1,5-a]pyridine (CID 134715341) is azane;3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfanylpyrazolo[1,5-a]pyridine.
What is the SMILES notation for azane;3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfanylpyrazolo[1,5-a]pyridine?
The canonical SMILES for azane;3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfanylpyrazolo[1,5-a]pyridine is CSc1nn2c(C)cc(C)cc2c1S(=O)(=O)c1ccccc1.N.
What is the InChIKey of azane;3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfanylpyrazolo[1,5-a]pyridine?
The InChIKey is OCNFRNNUQABYAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O2S2.H3N/c1-11-9-12(2)18-14(10-11)15(16(17-18)21-3)22(19,20)13-7-5-4-6-8-13;/h4-10H,1-3H3;1H3.
What are the key properties of azane;3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfanylpyrazolo[1,5-a]pyridine?
azane;3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfanylpyrazolo[1,5-a]pyridine has a molecular weight of 349.48 g/mol, XLogP of 3.67, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfanylpyrazolo[1,5-a]pyridine is sourced from PubChem (CID 134715341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).