About 1-butyl-2,3,5-trimethylpyrazol-2-ium;cyanoiminomethylideneazanide
1-butyl-2,3,5-trimethylpyrazol-2-ium;cyanoiminomethylideneazanide (PubChem CID 134716225) has the molecular formula C12H19N5
and a molecular weight of 233.32 g/mol. Its IUPAC name is 1-butyl-2,3,5-trimethylpyrazol-2-ium;cyanoiminomethylideneazanide.
Molecular Properties
| Compound Name | 1-butyl-2,3,5-trimethylpyrazol-2-ium;cyanoiminomethylideneazanide |
| PubChem CID | 134716225 |
| Molecular Formula | C12H19N5 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 1-butyl-2,3,5-trimethylpyrazol-2-ium;cyanoiminomethylideneazanide |
| SMILES | CCCCn1c(C)cc(C)[n+]1C.N#CN=C=[N-] |
| InChI | InChI=1S/C10H19N2.C2N3/c1-5-6-7-12-10(3)8-9(2)11(12)4;3-1-5-2-4/h8H,5-7H2,1-4H3;/q+1;-1 |
| InChIKey | ZOWGJWARIYJSOI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 67.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-2,3,5-trimethylpyrazol-2-ium;cyanoiminomethylideneazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2,3,5-trimethylpyrazol-2-ium;cyanoiminomethylideneazanide?
The IUPAC name of 1-butyl-2,3,5-trimethylpyrazol-2-ium;cyanoiminomethylideneazanide (CID 134716225) is 1-butyl-2,3,5-trimethylpyrazol-2-ium;cyanoiminomethylideneazanide.
What is the SMILES notation for 1-butyl-2,3,5-trimethylpyrazol-2-ium;cyanoiminomethylideneazanide?
The canonical SMILES for 1-butyl-2,3,5-trimethylpyrazol-2-ium;cyanoiminomethylideneazanide is CCCCn1c(C)cc(C)[n+]1C.N#CN=C=[N-].
What is the InChIKey of 1-butyl-2,3,5-trimethylpyrazol-2-ium;cyanoiminomethylideneazanide?
The InChIKey is ZOWGJWARIYJSOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N2.C2N3/c1-5-6-7-12-10(3)8-9(2)11(12)4;3-1-5-2-4/h8H,5-7H2,1-4H3;/q+1;-1.
What are the key properties of 1-butyl-2,3,5-trimethylpyrazol-2-ium;cyanoiminomethylideneazanide?
1-butyl-2,3,5-trimethylpyrazol-2-ium;cyanoiminomethylideneazanide has a molecular weight of 233.32 g/mol, XLogP of 1.94, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2,3,5-trimethylpyrazol-2-ium;cyanoiminomethylideneazanide is sourced from PubChem (CID 134716225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).