C19H22O5 — CID 134716372
[(E)-3-(4-hydroxy-5-methoxycyclohexa-2,4-dien-1-yl)prop-2-enyl] (E)-3-(4-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate (PubChem CID 134716372) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is [(E)-3-(4-hydroxy-5-methoxycyclohexa-2,4-dien-1-yl)prop-2-enyl] (E)-3-(4-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate.
| Compound Name | [(E)-3-(4-hydroxy-5-methoxycyclohexa-2,4-dien-1-yl)prop-2-enyl] (E)-3-(4-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate |
|---|---|
| PubChem CID | 134716372 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | [(E)-3-(4-hydroxy-5-methoxycyclohexa-2,4-dien-1-yl)prop-2-enyl] (E)-3-(4-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate |
| SMILES | COC1=C(O)C=CC(/C=C/COC(=O)/C=C/C2C=CC(O)=CC2)C1 |
| InChI | InChI=1S/C19H22O5/c1-23-18-13-15(6-10-17(18)21)3-2-12-24-19(22)11-7-14-4-8-16(20)9-5-14/h2-4,6-11,14-15,20-21H,5,12-13H2,1H3/b3-2+,11-7+ |
| InChIKey | HISSADDOZWQPGZ-LFWRRJNUSA-N |
| XLogP | 3.65 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|