About N-[2-[3,4-bis(triethylsilyloxy)phenyl]ethyl]-2-methylprop-2-enamide
N-[2-[3,4-bis(triethylsilyloxy)phenyl]ethyl]-2-methylprop-2-enamide (PubChem CID 134716501) has the molecular formula C24H43NO3Si2
and a molecular weight of 449.78 g/mol. Its IUPAC name is N-[2-[3,4-bis(triethylsilyloxy)phenyl]ethyl]-2-methylprop-2-enamide.
Molecular Properties
| Compound Name | N-[2-[3,4-bis(triethylsilyloxy)phenyl]ethyl]-2-methylprop-2-enamide |
| PubChem CID | 134716501 |
| Molecular Formula | C24H43NO3Si2 |
| Molecular Weight | 449.78 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | N-[2-[3,4-bis(triethylsilyloxy)phenyl]ethyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCc1ccc(O[Si](CC)(CC)CC)c(O[Si](CC)(CC)CC)c1 |
| InChI | InChI=1S/C24H43NO3Si2/c1-9-29(10-2,11-3)27-22-16-15-21(17-18-25-24(26)20(7)8)19-23(22)28-30(12-4,13-5)14-6/h15-16,19H,7,9-14,17-18H2,1-6,8H3,(H,25,26) |
| InChIKey | XOUVRSAYRWIBTR-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.78 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[3,4-bis(triethylsilyloxy)phenyl]ethyl]-2-methylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[3,4-bis(triethylsilyloxy)phenyl]ethyl]-2-methylprop-2-enamide?
The IUPAC name of N-[2-[3,4-bis(triethylsilyloxy)phenyl]ethyl]-2-methylprop-2-enamide (CID 134716501) is N-[2-[3,4-bis(triethylsilyloxy)phenyl]ethyl]-2-methylprop-2-enamide.
What is the SMILES notation for N-[2-[3,4-bis(triethylsilyloxy)phenyl]ethyl]-2-methylprop-2-enamide?
The canonical SMILES for N-[2-[3,4-bis(triethylsilyloxy)phenyl]ethyl]-2-methylprop-2-enamide is C=C(C)C(=O)NCCc1ccc(O[Si](CC)(CC)CC)c(O[Si](CC)(CC)CC)c1.
What is the InChIKey of N-[2-[3,4-bis(triethylsilyloxy)phenyl]ethyl]-2-methylprop-2-enamide?
The InChIKey is XOUVRSAYRWIBTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H43NO3Si2/c1-9-29(10-2,11-3)27-22-16-15-21(17-18-25-24(26)20(7)8)19-23(22)28-30(12-4,13-5)14-6/h15-16,19H,7,9-14,17-18H2,1-6,8H3,(H,25,26).
What are the key properties of N-[2-[3,4-bis(triethylsilyloxy)phenyl]ethyl]-2-methylprop-2-enamide?
N-[2-[3,4-bis(triethylsilyloxy)phenyl]ethyl]-2-methylprop-2-enamide has a molecular weight of 449.78 g/mol, XLogP of 6.69, 14 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[3,4-bis(triethylsilyloxy)phenyl]ethyl]-2-methylprop-2-enamide is sourced from PubChem (CID 134716501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).