About 2,3-dihydroxydodecanoate
2,3-dihydroxydodecanoate (PubChem CID 134716628) has the molecular formula C12H23O4-
and a molecular weight of 231.31 g/mol. Its IUPAC name is 2,3-dihydroxydodecanoate.
Molecular Properties
| Compound Name | 2,3-dihydroxydodecanoate |
| PubChem CID | 134716628 |
| Molecular Formula | C12H23O4- |
| Molecular Weight | 231.31 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 2,3-dihydroxydodecanoate |
| SMILES | CCCCCCCCCC(O)C(O)C(=O)[O-] |
| InChI | InChI=1S/C12H24O4/c1-2-3-4-5-6-7-8-9-10(13)11(14)12(15)16/h10-11,13-14H,2-9H2,1H3,(H,15,16)/p-1 |
| InChIKey | JJIJQULYODNGKJ-UHFFFAOYSA-M |
| XLogP | 0.60 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.31 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydroxydodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxydodecanoate?
The IUPAC name of 2,3-dihydroxydodecanoate (CID 134716628) is 2,3-dihydroxydodecanoate.
What is the SMILES notation for 2,3-dihydroxydodecanoate?
The canonical SMILES for 2,3-dihydroxydodecanoate is CCCCCCCCCC(O)C(O)C(=O)[O-].
What is the InChIKey of 2,3-dihydroxydodecanoate?
The InChIKey is JJIJQULYODNGKJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H24O4/c1-2-3-4-5-6-7-8-9-10(13)11(14)12(15)16/h10-11,13-14H,2-9H2,1H3,(H,15,16)/p-1.
What are the key properties of 2,3-dihydroxydodecanoate?
2,3-dihydroxydodecanoate has a molecular weight of 231.31 g/mol, XLogP of 0.60, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxydodecanoate is sourced from PubChem (CID 134716628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).