C28H20N4O5 — CID 134717117
3-(3,4-dimethoxyphenyl)-N-(5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)-1H-pyrazole-5-carboxamide (PubChem CID 134717117) has the molecular formula C28H20N4O5 and a molecular weight of 492.49 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-(5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-(5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 134717117 |
| Molecular Formula | C28H20N4O5 |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-(5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)-1H-pyrazole-5-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)Nn3c4c(c5ccccc5c3=O)C(=O)c3ccccc3-4)[nH]n2)cc1OC |
| InChI | InChI=1S/C28H20N4O5/c1-36-22-12-11-15(13-23(22)37-2)20-14-21(30-29-20)27(34)31-32-25-17-8-4-5-9-18(17)26(33)24(25)16-7-3-6-10-19(16)28(32)35/h3-14H,1-2H3,(H,29,30)(H,31,34) |
| InChIKey | MTFLLHNHRIOUSL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|