C42H66O10 — CID 134718070
[2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (8E,11E,14E)-heptadeca-8,11,14-trienoate (PubChem CID 134718070) has the molecular formula C42H66O10 and a molecular weight of 730.98 g/mol. Its IUPAC name is [2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (8E,11E,14E)-heptadeca-8,11,14-trienoate.
| Compound Name | [2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (8E,11E,14E)-heptadeca-8,11,14-trienoate |
|---|---|
| PubChem CID | 134718070 |
| Molecular Formula | C42H66O10 |
| Molecular Weight | 730.98 g/mol |
| Exact Mass | 730.47 |
| IUPAC Name | [2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (8E,11E,14E)-heptadeca-8,11,14-trienoate |
| SMILES | CC/C=C/C=C/C=C/C=C/CCCCCC(=O)OC(COC(=O)CCCCCC/C=C/C/C=C/C/C=C/CC)CO[C@H]1O[C@@H](CO)[C@@H](O)C(O)C1O |
| InChI | InChI=1S/C42H66O10/c1-3-5-7-9-11-13-15-17-19-20-22-24-26-28-30-37(44)49-33-35(34-50-42-41(48)40(47)39(46)36(32-43)52-42)51-38(45)31-29-27-25-23-21-18-16-14-12-10-8-6-4-2/h5-8,10-14,16-19,21,35-36,39-43,46-48H,3-4,9,15,20,22-34H2,1-2H3/b7-5+,8-6+,12-10+,13-11+,16-14+,19-17+,21-18+/t35?,36-,39+,40?,41?,42-/m0/s1 |
| InChIKey | AGLBMYLNTGLSFD-TYBYPCOSSA-N |
| XLogP | 7.04 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.98 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|