C37H65O13P — CID 134719335
[(2R)-1-decanoyloxy-3-[hydroxy-[(5R)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxypropan-2-yl] (9E,12E,15E)-octadeca-9,12,15-trienoate (PubChem CID 134719335) has the molecular formula C37H65O13P and a molecular weight of 748.89 g/mol. Its IUPAC name is [(2R)-1-decanoyloxy-3-[hydroxy-[(5R)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxypropan-2-yl] (9E,12E,15E)-octadeca-9,12,15-trienoate.
| Compound Name | [(2R)-1-decanoyloxy-3-[hydroxy-[(5R)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxypropan-2-yl] (9E,12E,15E)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 134719335 |
| Molecular Formula | C37H65O13P |
| Molecular Weight | 748.89 g/mol |
| Exact Mass | 748.42 |
| IUPAC Name | [(2R)-1-decanoyloxy-3-[hydroxy-[(5R)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxypropan-2-yl] (9E,12E,15E)-octadeca-9,12,15-trienoate |
| SMILES | CC/C=C/C/C=C/C/C=C/CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)[C@@H](O)C1O |
| InChI | InChI=1S/C37H65O13P/c1-3-5-7-9-11-12-13-14-15-16-17-18-20-22-24-26-31(39)49-29(27-47-30(38)25-23-21-19-10-8-6-4-2)28-48-51(45,46)50-37-35(43)33(41)32(40)34(42)36(37)44/h5,7,11-12,14-15,29,32-37,40-44H,3-4,6,8-10,13,16-28H2,1-2H3,(H,45,46)/b7-5+,12-11+,15-14+/t29-,32?,33-,34?,35?,36?,37?/m1/s1 |
| InChIKey | ASEVREDTTLPUEE-QDNLRTRTSA-N |
| XLogP | 5.49 |
| TPSA | 209.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 51 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.89 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|