C25H41NO — CID 134720140
1-[(2E,6Z,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperidin-2-one (PubChem CID 134720140) has the molecular formula C25H41NO and a molecular weight of 371.61 g/mol. Its IUPAC name is 1-[(2E,6Z,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperidin-2-one.
| Compound Name | 1-[(2E,6Z,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperidin-2-one |
|---|---|
| PubChem CID | 134720140 |
| Molecular Formula | C25H41NO |
| Molecular Weight | 371.61 g/mol |
| Exact Mass | 371.32 |
| IUPAC Name | 1-[(2E,6Z,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperidin-2-one |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C\CC/C(C)=C/CN1CCCCC1=O |
| InChI | InChI=1S/C25H41NO/c1-21(2)11-8-12-22(3)13-9-14-23(4)15-10-16-24(5)18-20-26-19-7-6-17-25(26)27/h11,13,15,18H,6-10,12,14,16-17,19-20H2,1-5H3/b22-13+,23-15-,24-18+ |
| InChIKey | AZXQGUBARWMYAD-RTEFFSRBSA-N |
| XLogP | 7.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.61 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|