C41H76NO8P — CID 134720141
[(2R)-2-[(9E,12E)-octadeca-9,12-dienoyl]oxy-3-[(E)-pentadec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 134720141) has the molecular formula C41H76NO8P and a molecular weight of 742.03 g/mol. Its IUPAC name is [(2R)-2-[(9E,12E)-octadeca-9,12-dienoyl]oxy-3-[(E)-pentadec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-2-[(9E,12E)-octadeca-9,12-dienoyl]oxy-3-[(E)-pentadec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 134720141 |
| Molecular Formula | C41H76NO8P |
| Molecular Weight | 742.03 g/mol |
| Exact Mass | 741.53 |
| IUPAC Name | [(2R)-2-[(9E,12E)-octadeca-9,12-dienoyl]oxy-3-[(E)-pentadec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCC/C=C/CCCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C41H76NO8P/c1-6-8-10-12-14-16-18-20-21-22-24-26-28-30-32-34-41(44)50-39(38-49-51(45,46)48-36-35-42(3,4)5)37-47-40(43)33-31-29-27-25-23-19-17-15-13-11-9-7-2/h14-17,20-21,39H,6-13,18-19,22-38H2,1-5H3/b16-14+,17-15+,21-20+/t39-/m1/s1 |
| InChIKey | AZXQLWBKLPGTHN-NRAJIUGMSA-N |
| XLogP | 10.33 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.03 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|