C44H83NO8P+ — CID 134720186
2-[hydroxy-[(2R)-2-[(6E,9E)-octadeca-6,9-dienoyl]oxy-3-[(E)-octadec-7-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 134720186) has the molecular formula C44H83NO8P+ and a molecular weight of 785.12 g/mol. Its IUPAC name is 2-[hydroxy-[(2R)-2-[(6E,9E)-octadeca-6,9-dienoyl]oxy-3-[(E)-octadec-7-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[(2R)-2-[(6E,9E)-octadeca-6,9-dienoyl]oxy-3-[(E)-octadec-7-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 134720186 |
| Molecular Formula | C44H83NO8P+ |
| Molecular Weight | 785.12 g/mol |
| Exact Mass | 784.59 |
| IUPAC Name | 2-[hydroxy-[(2R)-2-[(6E,9E)-octadeca-6,9-dienoyl]oxy-3-[(E)-octadec-7-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCCC/C=C/C/C=C/CCCCC(=O)O[C@H](COC(=O)CCCCC/C=C/CCCCCCCCCC)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C44H82NO8P/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-43(46)50-40-42(41-52-54(48,49)51-39-38-45(3,4)5)53-44(47)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h21,23-24,26-27,29,42H,6-20,22,25,28,30-41H2,1-5H3/p+1/b23-21+,26-24+,29-27+/t42-/m1/s1 |
| InChIKey | BAHSXWCXDOJMEP-RNEPYTICSA-O |
| XLogP | 12.13 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.12 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|