C38H66O4 — CID 134720568
11-[(9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoyl]oxytetradecanoic acid (PubChem CID 134720568) has the molecular formula C38H66O4 and a molecular weight of 586.94 g/mol. Its IUPAC name is 11-[(9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoyl]oxytetradecanoic acid.
| Compound Name | 11-[(9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoyl]oxytetradecanoic acid |
|---|---|
| PubChem CID | 134720568 |
| Molecular Formula | C38H66O4 |
| Molecular Weight | 586.94 g/mol |
| Exact Mass | 586.50 |
| IUPAC Name | 11-[(9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoyl]oxytetradecanoic acid |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC(CCC)CCCCCCCCCC(=O)O |
| InChI | InChI=1S/C38H66O4/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25-28-31-35-38(41)42-36(32-4-2)33-29-26-23-22-24-27-30-34-37(39)40/h8-9,11-12,14-15,17-18,36H,3-7,10,13,16,19-35H2,1-2H3,(H,39,40)/b9-8-,12-11-,15-14-,18-17- |
| InChIKey | BDUKLEFPEYMZRS-GKFVBPDJSA-N |
| XLogP | 12.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.94 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|