C26H50Si2 — CID 134722704
trimethyl-[(2Z,6E)-11-methyl-2-(4-methylpent-3-enyl)-7-(trimethylsilylmethyl)dodeca-2,6,10-trienyl]silane (PubChem CID 134722704) has the molecular formula C26H50Si2 and a molecular weight of 418.86 g/mol. Its IUPAC name is trimethyl-[(2Z,6E)-11-methyl-2-(4-methylpent-3-enyl)-7-(trimethylsilylmethyl)dodeca-2,6,10-trienyl]silane.
| Compound Name | trimethyl-[(2Z,6E)-11-methyl-2-(4-methylpent-3-enyl)-7-(trimethylsilylmethyl)dodeca-2,6,10-trienyl]silane |
|---|---|
| PubChem CID | 134722704 |
| Molecular Formula | C26H50Si2 |
| Molecular Weight | 418.86 g/mol |
| Exact Mass | 418.35 |
| IUPAC Name | trimethyl-[(2Z,6E)-11-methyl-2-(4-methylpent-3-enyl)-7-(trimethylsilylmethyl)dodeca-2,6,10-trienyl]silane |
| SMILES | CC(C)=CCC/C(=C/CC/C=C(\CCC=C(C)C)C[Si](C)(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C26H50Si2/c1-23(2)15-13-19-25(21-27(5,6)7)17-11-12-18-26(22-28(8,9)10)20-14-16-24(3)4/h15-18H,11-14,19-22H2,1-10H3/b25-17-,26-18+ |
| InChIKey | BWUTUMBXRSCEQW-WTHRLWDASA-N |
| XLogP | 9.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.86 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|