C15H29NO5Si — CID 134723250
methyl (Z,4R,5R)-5-carbamoyloxy-3-methyl-4-triethylsilyloxyhex-2-enoate (PubChem CID 134723250) has the molecular formula C15H29NO5Si and a molecular weight of 331.49 g/mol. Its IUPAC name is methyl (Z,4R,5R)-5-carbamoyloxy-3-methyl-4-triethylsilyloxyhex-2-enoate.
| Compound Name | methyl (Z,4R,5R)-5-carbamoyloxy-3-methyl-4-triethylsilyloxyhex-2-enoate |
|---|---|
| PubChem CID | 134723250 |
| Molecular Formula | C15H29NO5Si |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | methyl (Z,4R,5R)-5-carbamoyloxy-3-methyl-4-triethylsilyloxyhex-2-enoate |
| SMILES | CC[Si](CC)(CC)O[C@H](/C(C)=C\C(=O)OC)[C@@H](C)OC(N)=O |
| InChI | InChI=1S/C15H29NO5Si/c1-7-22(8-2,9-3)21-14(12(5)20-15(16)18)11(4)10-13(17)19-6/h10,12,14H,7-9H2,1-6H3,(H2,16,18)/b11-10-/t12-,14-/m1/s1 |
| InChIKey | CBVOENHYXRKIRF-XVGBTMSLSA-N |
| XLogP | 2.98 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|