C39H68O12S — CID 134724266
[(2S,3S,6S)-6-[(2S)-3-decanoyloxy-2-[(5E,8E,11E)-icosa-5,8,11-trienoyl]oxypropoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid (PubChem CID 134724266) has the molecular formula C39H68O12S and a molecular weight of 761.03 g/mol. Its IUPAC name is [(2S,3S,6S)-6-[(2S)-3-decanoyloxy-2-[(5E,8E,11E)-icosa-5,8,11-trienoyl]oxypropoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid.
| Compound Name | [(2S,3S,6S)-6-[(2S)-3-decanoyloxy-2-[(5E,8E,11E)-icosa-5,8,11-trienoyl]oxypropoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 134724266 |
| Molecular Formula | C39H68O12S |
| Molecular Weight | 761.03 g/mol |
| Exact Mass | 760.44 |
| IUPAC Name | [(2S,3S,6S)-6-[(2S)-3-decanoyloxy-2-[(5E,8E,11E)-icosa-5,8,11-trienoyl]oxypropoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid |
| SMILES | CCCCCCCC/C=C/C/C=C/C/C=C/CCCC(=O)O[C@H](COC(=O)CCCCCCCCC)CO[C@H]1O[C@H](CS(=O)(=O)O)[C@@H](O)C(O)C1O |
| InChI | InChI=1S/C39H68O12S/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-22-24-26-28-35(41)50-32(29-48-34(40)27-25-23-21-10-8-6-4-2)30-49-39-38(44)37(43)36(42)33(51-39)31-52(45,46)47/h14-15,17-18,20,22,32-33,36-39,42-44H,3-13,16,19,21,23-31H2,1-2H3,(H,45,46,47)/b15-14+,18-17+,22-20+/t32-,33-,36-,37?,38?,39+/m1/s1 |
| InChIKey | CLCZENMFRFIRKJ-FIPKLHIZSA-N |
| XLogP | 6.66 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.03 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|