C33H52O7 — CID 13472494
methyl (Z)-7-[(1R,2R,3R,5S)-5-hydroxy-2-[(E,3S)-4-methyl-3-(oxan-2-yloxy)non-1-en-6-ynyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate (PubChem CID 13472494) has the molecular formula C33H52O7 and a molecular weight of 560.77 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2R,3R,5S)-5-hydroxy-2-[(E,3S)-4-methyl-3-(oxan-2-yloxy)non-1-en-6-ynyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2R,3R,5S)-5-hydroxy-2-[(E,3S)-4-methyl-3-(oxan-2-yloxy)non-1-en-6-ynyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 13472494 |
| Molecular Formula | C33H52O7 |
| Molecular Weight | 560.77 g/mol |
| Exact Mass | 560.37 |
| IUPAC Name | methyl (Z)-7-[(1R,2R,3R,5S)-5-hydroxy-2-[(E,3S)-4-methyl-3-(oxan-2-yloxy)non-1-en-6-ynyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
| SMILES | CCC#CCC(C)[C@@H](/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)OC)[C@@H](O)C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C33H52O7/c1-4-5-8-15-25(2)29(39-32-18-11-13-22-37-32)21-20-27-26(16-9-6-7-10-17-31(35)36-3)28(34)24-30(27)40-33-19-12-14-23-38-33/h6,9,20-21,25-30,32-34H,4,7,10-19,22-24H2,1-3H3/b9-6-,21-20+/t25?,26-,27-,28+,29-,30-,32?,33?/m1/s1 |
| InChIKey | NZXZLASXEBTGTA-QZENSKKFSA-N |
| XLogP | 6.09 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.77 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|