C35H61O10P — CID 134726178
[(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-undecanoyloxypropan-2-yl] (6E,9E,12E,15E)-octadeca-6,9,12,15-tetraenoate (PubChem CID 134726178) has the molecular formula C35H61O10P and a molecular weight of 672.84 g/mol. Its IUPAC name is [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-undecanoyloxypropan-2-yl] (6E,9E,12E,15E)-octadeca-6,9,12,15-tetraenoate.
| Compound Name | [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-undecanoyloxypropan-2-yl] (6E,9E,12E,15E)-octadeca-6,9,12,15-tetraenoate |
|---|---|
| PubChem CID | 134726178 |
| Molecular Formula | C35H61O10P |
| Molecular Weight | 672.84 g/mol |
| Exact Mass | 672.40 |
| IUPAC Name | [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-undecanoyloxypropan-2-yl] (6E,9E,12E,15E)-octadeca-6,9,12,15-tetraenoate |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/CCCCC(=O)O[C@H](COC(=O)CCCCCCCCCC)COP(=O)(O)OC[C@@H](O)CO |
| InChI | InChI=1S/C35H61O10P/c1-3-5-7-9-11-13-14-15-16-17-18-19-21-23-25-27-35(39)45-33(31-44-46(40,41)43-29-32(37)28-36)30-42-34(38)26-24-22-20-12-10-8-6-4-2/h5,7,11,13,15-16,18-19,32-33,36-37H,3-4,6,8-10,12,14,17,20-31H2,1-2H3,(H,40,41)/b7-5+,13-11+,16-15+,19-18+/t32-,33+/m0/s1 |
| InChIKey | DCPJOUACLXHVEK-LAKILJCGSA-N |
| XLogP | 7.82 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.84 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|