C42H76O15 — CID 134726440
[(2S)-1-[(2R,5R,6R)-3,4,5-trihydroxy-6-[[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-3-undecanoyloxypropan-2-yl] (E)-hexadec-7-enoate (PubChem CID 134726440) has the molecular formula C42H76O15 and a molecular weight of 821.05 g/mol. Its IUPAC name is [(2S)-1-[(2R,5R,6R)-3,4,5-trihydroxy-6-[[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-3-undecanoyloxypropan-2-yl] (E)-hexadec-7-enoate.
| Compound Name | [(2S)-1-[(2R,5R,6R)-3,4,5-trihydroxy-6-[[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-3-undecanoyloxypropan-2-yl] (E)-hexadec-7-enoate |
|---|---|
| PubChem CID | 134726440 |
| Molecular Formula | C42H76O15 |
| Molecular Weight | 821.05 g/mol |
| Exact Mass | 820.52 |
| IUPAC Name | [(2S)-1-[(2R,5R,6R)-3,4,5-trihydroxy-6-[[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-3-undecanoyloxypropan-2-yl] (E)-hexadec-7-enoate |
| SMILES | CCCCCCCC/C=C/CCCCCC(=O)O[C@H](COC(=O)CCCCCCCCCC)CO[C@@H]1O[C@H](CO[C@@H]2O[C@H](CO)[C@H](O)C(O)C2O)[C@H](O)C(O)C1O |
| InChI | InChI=1S/C42H76O15/c1-3-5-7-9-11-13-14-15-16-17-19-21-23-25-34(45)55-30(27-52-33(44)24-22-20-18-12-10-8-6-4-2)28-53-41-40(51)38(49)36(47)32(57-41)29-54-42-39(50)37(48)35(46)31(26-43)56-42/h15-16,30-32,35-43,46-51H,3-14,17-29H2,1-2H3/b16-15+/t30-,31-,32-,35+,36+,37?,38?,39?,40?,41-,42-/m1/s1 |
| InChIKey | DEZJLKFSAUSSMY-NINCEXDYSA-N |
| XLogP | 3.87 |
| TPSA | 231.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.05 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|